N-(3-chloro-4-fluorophenyl)-3-ethyl-2-oxo-2,3-dihydro-1,3-benzothiazole-6-sulfonamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-3-ethyl-2-oxo-2,3-dihydro-1,3-benzothiazole-6-sulfonamide
N-(3-chloro-4-fluorophenyl)-3-ethyl-2-oxo-2,3-dihydro-1,3-benzothiazole-6-sulfonamide
Compound characteristics
| Compound ID: | F818-0946 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-3-ethyl-2-oxo-2,3-dihydro-1,3-benzothiazole-6-sulfonamide |
| Molecular Weight: | 386.85 |
| Molecular Formula: | C15 H12 Cl F N2 O3 S2 |
| Smiles: | CCN1C(=O)Sc2cc(ccc12)S(Nc1ccc(c(c1)[Cl])F)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3731 |
| logD: | 2.9593 |
| logSw: | -4.4475 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.457 |
| InChI Key: | MHZVLVHVRMYNIZ-UHFFFAOYSA-N |