5-[2-(4-methoxyphenyl)ethenyl]-3-[4-(pyrrolidine-1-sulfonyl)phenyl]-1,2,4-oxadiazole
Chemical Structure Depiction of
5-[2-(4-methoxyphenyl)ethenyl]-3-[4-(pyrrolidine-1-sulfonyl)phenyl]-1,2,4-oxadiazole
5-[2-(4-methoxyphenyl)ethenyl]-3-[4-(pyrrolidine-1-sulfonyl)phenyl]-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | F819-0063 |
| Compound Name: | 5-[2-(4-methoxyphenyl)ethenyl]-3-[4-(pyrrolidine-1-sulfonyl)phenyl]-1,2,4-oxadiazole |
| Molecular Weight: | 411.48 |
| Molecular Formula: | C21 H21 N3 O4 S |
| Smiles: | COc1ccc(/C=C/c2nc(c3ccc(cc3)S(N3CCCC3)(=O)=O)no2)cc1 |
| Stereo: | ACHIRAL |
| logP: | 4.7012 |
| logD: | 4.7012 |
| logSw: | -4.3543 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 70.931 |
| InChI Key: | WZARODFQDONBFE-UHFFFAOYSA-N |