N-(3,4-dimethylphenyl)-5-(3-methyl-1H-pyrazol-5-yl)furan-2-sulfonamide
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-5-(3-methyl-1H-pyrazol-5-yl)furan-2-sulfonamide
N-(3,4-dimethylphenyl)-5-(3-methyl-1H-pyrazol-5-yl)furan-2-sulfonamide
Compound characteristics
| Compound ID: | F825-0107 |
| Compound Name: | N-(3,4-dimethylphenyl)-5-(3-methyl-1H-pyrazol-5-yl)furan-2-sulfonamide |
| Molecular Weight: | 331.39 |
| Molecular Formula: | C16 H17 N3 O3 S |
| Smiles: | Cc1ccc(cc1C)NS(c1ccc(c2cc(C)n[nH]2)o1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9837 |
| logD: | 3.9407 |
| logSw: | -3.9183 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.076 |
| InChI Key: | MRERQRRARFMSDQ-UHFFFAOYSA-N |