N-(5-chloro-2-methylphenyl)-1-(4-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
Chemical Structure Depiction of
N-(5-chloro-2-methylphenyl)-1-(4-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
N-(5-chloro-2-methylphenyl)-1-(4-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide
Compound characteristics
| Compound ID: | F828-0429 |
| Compound Name: | N-(5-chloro-2-methylphenyl)-1-(4-fluorophenyl)-3,5-dimethyl-1H-pyrazole-4-sulfonamide |
| Molecular Weight: | 393.87 |
| Molecular Formula: | C18 H17 Cl F N3 O2 S |
| Smiles: | Cc1ccc(cc1NS(c1c(C)nn(c2ccc(cc2)F)c1C)(=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 3.809 |
| logD: | 2.9244 |
| logSw: | -4.2747 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.608 |
| InChI Key: | SKJIVKBSUVPYDO-UHFFFAOYSA-N |