3-[4-(2-chlorophenyl)piperazine-1-sulfonyl]-N-(4-methoxyphenyl)thiophene-2-carboxamide
Chemical Structure Depiction of
3-[4-(2-chlorophenyl)piperazine-1-sulfonyl]-N-(4-methoxyphenyl)thiophene-2-carboxamide
3-[4-(2-chlorophenyl)piperazine-1-sulfonyl]-N-(4-methoxyphenyl)thiophene-2-carboxamide
Compound characteristics
| Compound ID: | F836-0786 |
| Compound Name: | 3-[4-(2-chlorophenyl)piperazine-1-sulfonyl]-N-(4-methoxyphenyl)thiophene-2-carboxamide |
| Molecular Weight: | 492.01 |
| Molecular Formula: | C22 H22 Cl N3 O4 S2 |
| Smiles: | COc1ccc(cc1)NC(c1c(ccs1)S(N1CCN(CC1)c1ccccc1[Cl])(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3116 |
| logD: | 4.3112 |
| logSw: | -4.3409 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.562 |
| InChI Key: | RGSUPNJJNURNHF-UHFFFAOYSA-N |