3-(2-methoxyphenyl)-5-{5-[(4-methylbenzene-1-sulfonyl)methyl]furan-2-yl}-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(2-methoxyphenyl)-5-{5-[(4-methylbenzene-1-sulfonyl)methyl]furan-2-yl}-1,2,4-oxadiazole
3-(2-methoxyphenyl)-5-{5-[(4-methylbenzene-1-sulfonyl)methyl]furan-2-yl}-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | F838-0697 |
| Compound Name: | 3-(2-methoxyphenyl)-5-{5-[(4-methylbenzene-1-sulfonyl)methyl]furan-2-yl}-1,2,4-oxadiazole |
| Molecular Weight: | 410.45 |
| Molecular Formula: | C21 H18 N2 O5 S |
| Smiles: | Cc1ccc(cc1)S(Cc1ccc(c2nc(c3ccccc3OC)no2)o1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3468 |
| logD: | 4.3468 |
| logSw: | -4.5562 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 75.881 |
| InChI Key: | YELFTQBVNZWVCR-UHFFFAOYSA-N |