6-(2-fluorophenyl)-2-({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)pyridazin-3(2H)-one
Chemical Structure Depiction of
6-(2-fluorophenyl)-2-({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)pyridazin-3(2H)-one
6-(2-fluorophenyl)-2-({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)pyridazin-3(2H)-one
Compound characteristics
| Compound ID: | F839-0696 |
| Compound Name: | 6-(2-fluorophenyl)-2-({3-[4-(trifluoromethyl)phenyl]-1,2,4-oxadiazol-5-yl}methyl)pyridazin-3(2H)-one |
| Molecular Weight: | 416.33 |
| Molecular Formula: | C20 H12 F4 N4 O2 |
| Smiles: | C(c1nc(c2ccc(cc2)C(F)(F)F)no1)N1C(C=CC(c2ccccc2F)=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6734 |
| logD: | 4.6734 |
| logSw: | -4.8481 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 59.89 |
| InChI Key: | KEBVBEVRBSZPFA-UHFFFAOYSA-N |