6-(2-fluorophenyl)-2-{[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}pyridazin-3(2H)-one
Chemical Structure Depiction of
6-(2-fluorophenyl)-2-{[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}pyridazin-3(2H)-one
6-(2-fluorophenyl)-2-{[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}pyridazin-3(2H)-one
Compound characteristics
| Compound ID: | F839-0697 |
| Compound Name: | 6-(2-fluorophenyl)-2-{[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl}pyridazin-3(2H)-one |
| Molecular Weight: | 362.36 |
| Molecular Formula: | C20 H15 F N4 O2 |
| Smiles: | Cc1ccccc1c1nc(CN2C(C=CC(c3ccccc3F)=N2)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.8186 |
| logD: | 3.8186 |
| logSw: | -4.0497 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 59.89 |
| InChI Key: | HKLBFRRMAJIEMI-UHFFFAOYSA-N |