N-(3-chlorophenyl)-2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-methylthiophene-3-sulfonamide
Chemical Structure Depiction of
N-(3-chlorophenyl)-2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-methylthiophene-3-sulfonamide
N-(3-chlorophenyl)-2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-methylthiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F845-0760 |
| Compound Name: | N-(3-chlorophenyl)-2-[3-(3,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-methylthiophene-3-sulfonamide |
| Molecular Weight: | 491.97 |
| Molecular Formula: | C21 H18 Cl N3 O5 S2 |
| Smiles: | CN(c1cccc(c1)[Cl])S(c1ccsc1c1nc(c2ccc(c(c2)OC)OC)no1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.34 |
| logD: | 5.34 |
| logSw: | -5.9973 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 80.745 |
| InChI Key: | YEDUDFWQUDRFIS-UHFFFAOYSA-N |