N-{3-[(butan-2-yl)carbamoyl]phenyl}-5-ethyl-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
N-{3-[(butan-2-yl)carbamoyl]phenyl}-5-ethyl-1,3,4-thiadiazole-2-carboxamide
N-{3-[(butan-2-yl)carbamoyl]phenyl}-5-ethyl-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | F854-0014 |
| Compound Name: | N-{3-[(butan-2-yl)carbamoyl]phenyl}-5-ethyl-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 332.42 |
| Molecular Formula: | C16 H20 N4 O2 S |
| Smiles: | CCC(C)NC(c1cccc(c1)NC(c1nnc(CC)s1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5214 |
| logD: | 2.5213 |
| logSw: | -3.0131 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.455 |
| InChI Key: | WQLOPONBYSOIGG-JTQLQIEISA-N |