N-[(3-fluorophenyl)methyl]-1-[1-(propan-2-yl)-1H-benzotriazole-5-sulfonyl]piperidine-3-carboxamide
Chemical Structure Depiction of
N-[(3-fluorophenyl)methyl]-1-[1-(propan-2-yl)-1H-benzotriazole-5-sulfonyl]piperidine-3-carboxamide
N-[(3-fluorophenyl)methyl]-1-[1-(propan-2-yl)-1H-benzotriazole-5-sulfonyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | F856-0268 |
| Compound Name: | N-[(3-fluorophenyl)methyl]-1-[1-(propan-2-yl)-1H-benzotriazole-5-sulfonyl]piperidine-3-carboxamide |
| Molecular Weight: | 459.54 |
| Molecular Formula: | C22 H26 F N5 O3 S |
| Smiles: | CC(C)n1c2ccc(cc2nn1)S(N1CCCC(C1)C(NCc1cccc(c1)F)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.4682 |
| logD: | 2.4681 |
| logSw: | -2.7795 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 82.462 |
| InChI Key: | KTRYFOWVIAXOSD-KRWDZBQOSA-N |