propan-2-yl 5-{4-[2-(benzylamino)-2-oxoethyl]piperidine-1-carbonyl}-2,4-dimethyl-1H-pyrrole-3-carboxylate
Chemical Structure Depiction of
propan-2-yl 5-{4-[2-(benzylamino)-2-oxoethyl]piperidine-1-carbonyl}-2,4-dimethyl-1H-pyrrole-3-carboxylate
propan-2-yl 5-{4-[2-(benzylamino)-2-oxoethyl]piperidine-1-carbonyl}-2,4-dimethyl-1H-pyrrole-3-carboxylate
Compound characteristics
| Compound ID: | F862-0319 |
| Compound Name: | propan-2-yl 5-{4-[2-(benzylamino)-2-oxoethyl]piperidine-1-carbonyl}-2,4-dimethyl-1H-pyrrole-3-carboxylate |
| Molecular Weight: | 439.55 |
| Molecular Formula: | C25 H33 N3 O4 |
| Smiles: | CC(C)OC(c1c(C)c(C(N2CCC(CC2)CC(NCc2ccccc2)=O)=O)[nH]c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4624 |
| logD: | 3.4624 |
| logSw: | -3.7428 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.501 |
| InChI Key: | QZMABTTZEUCWOA-UHFFFAOYSA-N |