5-(4-{2-[(butan-2-yl)amino]-2-oxoethyl}piperidine-1-carbonyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide
Chemical Structure Depiction of
5-(4-{2-[(butan-2-yl)amino]-2-oxoethyl}piperidine-1-carbonyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide
5-(4-{2-[(butan-2-yl)amino]-2-oxoethyl}piperidine-1-carbonyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide
Compound characteristics
| Compound ID: | F865-0521 |
| Compound Name: | 5-(4-{2-[(butan-2-yl)amino]-2-oxoethyl}piperidine-1-carbonyl)-N-phenyl-1,3,4-thiadiazole-2-carboxamide |
| Molecular Weight: | 429.54 |
| Molecular Formula: | C21 H27 N5 O3 S |
| Smiles: | CCC(C)NC(CC1CCN(CC1)C(c1nnc(C(Nc2ccccc2)=O)s1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.562 |
| logD: | 2.5612 |
| logSw: | -3.032 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 87.395 |
| InChI Key: | DTNDTNSEXMLBBN-AWEZNQCLSA-N |