N-cyclohexyl-N-methyl-4-{[2-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide
Chemical Structure Depiction of
N-cyclohexyl-N-methyl-4-{[2-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide
N-cyclohexyl-N-methyl-4-{[2-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide
Compound characteristics
| Compound ID: | F870-0059 |
| Compound Name: | N-cyclohexyl-N-methyl-4-{[2-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide |
| Molecular Weight: | 400.52 |
| Molecular Formula: | C25 H28 N4 O |
| Smiles: | Cc1cccc(c1)c1nccc(Nc2ccc(cc2)C(N(C)C2CCCCC2)=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.3045 |
| logD: | 5.0234 |
| logSw: | -5.1956 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.652 |
| InChI Key: | SBXBPONHSHBWLL-UHFFFAOYSA-N |