N-[(4-chlorophenyl)methyl]-3-{[2-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide
Chemical Structure Depiction of
N-[(4-chlorophenyl)methyl]-3-{[2-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide
N-[(4-chlorophenyl)methyl]-3-{[2-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide
Compound characteristics
| Compound ID: | F871-0081 |
| Compound Name: | N-[(4-chlorophenyl)methyl]-3-{[2-(3-methylphenyl)pyrimidin-4-yl]amino}benzamide |
| Molecular Weight: | 428.92 |
| Molecular Formula: | C25 H21 Cl N4 O |
| Smiles: | Cc1cccc(c1)c1nccc(Nc2cccc(c2)C(NCc2ccc(cc2)[Cl])=O)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.8497 |
| logD: | 5.5686 |
| logSw: | -6.0513 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.863 |
| InChI Key: | XNRDLDLPDUCJSH-UHFFFAOYSA-N |