N-(3-methylbutyl)-3-{[2-(4-methylphenyl)pyrimidin-4-yl]amino}benzamide
Chemical Structure Depiction of
N-(3-methylbutyl)-3-{[2-(4-methylphenyl)pyrimidin-4-yl]amino}benzamide
N-(3-methylbutyl)-3-{[2-(4-methylphenyl)pyrimidin-4-yl]amino}benzamide
Compound characteristics
| Compound ID: | F871-0631 |
| Compound Name: | N-(3-methylbutyl)-3-{[2-(4-methylphenyl)pyrimidin-4-yl]amino}benzamide |
| Molecular Weight: | 374.48 |
| Molecular Formula: | C23 H26 N4 O |
| Smiles: | CC(C)CCNC(c1cccc(c1)Nc1ccnc(c2ccc(C)cc2)n1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3356 |
| logD: | 4.8442 |
| logSw: | -5.2879 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.976 |
| InChI Key: | YQAWLXLEUYRSSE-UHFFFAOYSA-N |