1-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonyl]-N-(2,5-dimethylphenyl)piperidine-4-carboxamide
Chemical Structure Depiction of
1-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonyl]-N-(2,5-dimethylphenyl)piperidine-4-carboxamide
1-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonyl]-N-(2,5-dimethylphenyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | F891-1600 |
| Compound Name: | 1-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonyl]-N-(2,5-dimethylphenyl)piperidine-4-carboxamide |
| Molecular Weight: | 514.67 |
| Molecular Formula: | C25 H30 N4 O4 S2 |
| Smiles: | Cc1ccc(C)c(c1)NC(C1CCN(CC1)S(c1cc(c2nc(C3CCC3)on2)sc1C)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.529 |
| logD: | 4.529 |
| logSw: | -4.1151 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.29 |
| InChI Key: | UQPNNUUNTWODMC-UHFFFAOYSA-N |