N-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-3-yl]furan-2-carboxamide
Chemical Structure Depiction of
N-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-3-yl]furan-2-carboxamide
N-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-3-yl]furan-2-carboxamide
Compound characteristics
| Compound ID: | F892-0061 |
| Compound Name: | N-[2-methyl-5-(5-methyl-1,2,4-oxadiazol-3-yl)thiophen-3-yl]furan-2-carboxamide |
| Molecular Weight: | 289.31 |
| Molecular Formula: | C13 H11 N3 O3 S |
| Smiles: | Cc1nc(c2cc(c(C)s2)NC(c2ccco2)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 2.7721 |
| logD: | 2.772 |
| logSw: | -3.2998 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.134 |
| InChI Key: | YBTOCVZCSHIPTP-UHFFFAOYSA-N |