N-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophen-3-yl]-1-(4-methylbenzene-1-sulfonyl)piperidine-4-carboxamide
Chemical Structure Depiction of
N-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophen-3-yl]-1-(4-methylbenzene-1-sulfonyl)piperidine-4-carboxamide
N-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophen-3-yl]-1-(4-methylbenzene-1-sulfonyl)piperidine-4-carboxamide
Compound characteristics
| Compound ID: | F892-0152 |
| Compound Name: | N-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophen-3-yl]-1-(4-methylbenzene-1-sulfonyl)piperidine-4-carboxamide |
| Molecular Weight: | 474.6 |
| Molecular Formula: | C22 H26 N4 O4 S2 |
| Smiles: | CCc1nc(c2cc(c(C)s2)NC(C2CCN(CC2)S(c2ccc(C)cc2)(=O)=O)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 4.3995 |
| logD: | 4.3995 |
| logSw: | -4.1343 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 86.704 |
| InChI Key: | SAZWJKIIQPWGTJ-UHFFFAOYSA-N |