N-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylthiophen-3-yl]-2-methoxybenzamide
Chemical Structure Depiction of
N-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylthiophen-3-yl]-2-methoxybenzamide
N-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylthiophen-3-yl]-2-methoxybenzamide
Compound characteristics
| Compound ID: | F892-0690 |
| Compound Name: | N-[5-(5-cyclobutyl-1,2,4-oxadiazol-3-yl)-2-methylthiophen-3-yl]-2-methoxybenzamide |
| Molecular Weight: | 369.44 |
| Molecular Formula: | C19 H19 N3 O3 S |
| Smiles: | Cc1c(cc(c2nc(C3CCC3)on2)s1)NC(c1ccccc1OC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3237 |
| logD: | 4.3229 |
| logSw: | -4.3924 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.209 |
| InChI Key: | JLXRJNHHSABSFA-UHFFFAOYSA-N |