1-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonyl]-N-(3-ethylphenyl)piperidine-3-carboxamide
Chemical Structure Depiction of
1-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonyl]-N-(3-ethylphenyl)piperidine-3-carboxamide
1-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonyl]-N-(3-ethylphenyl)piperidine-3-carboxamide
Compound characteristics
| Compound ID: | F894-0536 |
| Compound Name: | 1-[5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2-methylthiophene-3-sulfonyl]-N-(3-ethylphenyl)piperidine-3-carboxamide |
| Molecular Weight: | 488.63 |
| Molecular Formula: | C23 H28 N4 O4 S2 |
| Smiles: | CCc1cccc(c1)NC(C1CCCN(C1)S(c1cc(c2nc(CC)on2)sc1C)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.5477 |
| logD: | 4.5477 |
| logSw: | -4.3185 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 87.335 |
| InChI Key: | BQLHEYDABNOKRQ-KRWDZBQOSA-N |