(1-phenylcyclopropyl)[4-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
(1-phenylcyclopropyl)[4-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone
(1-phenylcyclopropyl)[4-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | F897-0686 |
| Compound Name: | (1-phenylcyclopropyl)[4-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone |
| Molecular Weight: | 402.51 |
| Molecular Formula: | C20 H26 N4 O3 S |
| Smiles: | Cc1c(c(C)n(C)n1)S(N1CCN(CC1)C(C1(CC1)c1ccccc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.7675 |
| logD: | 0.7675 |
| logSw: | -1.9774 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 63.496 |
| InChI Key: | DFFIAZHYWWOQKC-UHFFFAOYSA-N |