(3,4-difluorophenyl)[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
(3,4-difluorophenyl)[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone
(3,4-difluorophenyl)[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | F897-0788 |
| Compound Name: | (3,4-difluorophenyl)[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone |
| Molecular Weight: | 412.46 |
| Molecular Formula: | C18 H22 F2 N4 O3 S |
| Smiles: | CCn1c(C)c(c(C)n1)S(N1CCN(CC1)C(c1ccc(c(c1)F)F)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1055 |
| logD: | 1.1055 |
| logSw: | -2.3606 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 62.684 |
| InChI Key: | DTSSUXIVQIYTLM-UHFFFAOYSA-N |