1-[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one
Chemical Structure Depiction of
1-[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one
1-[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one
Compound characteristics
| Compound ID: | F897-0812 |
| Compound Name: | 1-[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]-3-(4-methylphenyl)prop-2-en-1-one |
| Molecular Weight: | 416.54 |
| Molecular Formula: | C21 H28 N4 O3 S |
| Smiles: | CCn1c(C)c(c(C)n1)S(N1CCN(CC1)C(/C=C/c1ccc(C)cc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9332 |
| logD: | 1.9332 |
| logSw: | -2.454 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 62.156 |
| InChI Key: | GWKVEHGMDIVHHZ-UHFFFAOYSA-N |