(4-chloro-2-methoxyphenyl)[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
(4-chloro-2-methoxyphenyl)[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone
(4-chloro-2-methoxyphenyl)[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | F897-0857 |
| Compound Name: | (4-chloro-2-methoxyphenyl)[4-(1-ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonyl)piperazin-1-yl]methanone |
| Molecular Weight: | 440.95 |
| Molecular Formula: | C19 H25 Cl N4 O4 S |
| Smiles: | CCn1c(C)c(c(C)n1)S(N1CCN(CC1)C(c1ccc(cc1OC)[Cl])=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8085 |
| logD: | 1.8085 |
| logSw: | -2.9685 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 70.314 |
| InChI Key: | WRSUNBURKZFJAM-UHFFFAOYSA-N |