N-(3,5-dimethoxyphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
N-(3,5-dimethoxyphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F902-0045 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 394.47 |
| Molecular Formula: | C17 H18 N2 O5 S2 |
| Smiles: | Cc1cc(c2cc(c(C)s2)S(Nc2cc(cc(c2)OC)OC)(=O)=O)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.726 |
| logD: | 3.2211 |
| logSw: | -3.9877 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.336 |
| InChI Key: | HRCLTZIAHNLICT-UHFFFAOYSA-N |