N-(2,3-dimethylphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
Chemical Structure Depiction of
N-(2,3-dimethylphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
N-(2,3-dimethylphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide
Compound characteristics
| Compound ID: | F902-0047 |
| Compound Name: | N-(2,3-dimethylphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)thiophene-3-sulfonamide |
| Molecular Weight: | 362.47 |
| Molecular Formula: | C17 H18 N2 O3 S2 |
| Smiles: | Cc1cccc(c1C)NS(c1cc(c2cc(C)no2)sc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5344 |
| logD: | 4.5225 |
| logSw: | -4.2674 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.55 |
| InChI Key: | HJQHKFGDBVTYTF-UHFFFAOYSA-N |