N-[(4-fluorophenyl)methyl]-3,5-dimethyl-N-[2-oxo-2-(piperazin-1-yl)ethyl]benzamide--trifluoroacetic acid (1/1)
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-3,5-dimethyl-N-[2-oxo-2-(piperazin-1-yl)ethyl]benzamide--trifluoroacetic acid (1/1)
N-[(4-fluorophenyl)methyl]-3,5-dimethyl-N-[2-oxo-2-(piperazin-1-yl)ethyl]benzamide--trifluoroacetic acid (1/1)
Compound characteristics
| Compound ID: | F915-0509 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-3,5-dimethyl-N-[2-oxo-2-(piperazin-1-yl)ethyl]benzamide--trifluoroacetic acid (1/1) |
| Molecular Weight: | 497.49 |
| Molecular Formula: | C22 H26 F N3 O2 |
| Salt: | CF3COOH |
| Smiles: | Cc1cc(C)cc(c1)C(N(CC(N1CCNCC1)=O)Cc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 1.8578 |
| logD: | 1.2983 |
| logSw: | -2.4186 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.531 |
| InChI Key: | DGKTVZFJCFQGEI-UHFFFAOYSA-N |