3-(3-{[(5-methylfuran-2-yl)methyl]carbamoyl}phenyl)-N-phenylpiperidine-1-carboxamide
Chemical Structure Depiction of
3-(3-{[(5-methylfuran-2-yl)methyl]carbamoyl}phenyl)-N-phenylpiperidine-1-carboxamide
3-(3-{[(5-methylfuran-2-yl)methyl]carbamoyl}phenyl)-N-phenylpiperidine-1-carboxamide
Compound characteristics
| Compound ID: | F926-0947 |
| Compound Name: | 3-(3-{[(5-methylfuran-2-yl)methyl]carbamoyl}phenyl)-N-phenylpiperidine-1-carboxamide |
| Molecular Weight: | 417.51 |
| Molecular Formula: | C25 H27 N3 O3 |
| Smiles: | Cc1ccc(CNC(c2cccc(c2)C2CCCN(C2)C(Nc2ccccc2)=O)=O)o1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3986 |
| logD: | 4.3985 |
| logSw: | -4.2451 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.046 |
| InChI Key: | IEVCBXSBHHSGCR-NRFANRHFSA-N |