N-[4-(5-chloro-1H-indol-2-yl)phenyl]-2-(thiophen-2-yl)acetamide
Chemical Structure Depiction of
N-[4-(5-chloro-1H-indol-2-yl)phenyl]-2-(thiophen-2-yl)acetamide
N-[4-(5-chloro-1H-indol-2-yl)phenyl]-2-(thiophen-2-yl)acetamide
Compound characteristics
| Compound ID: | F940-0635 |
| Compound Name: | N-[4-(5-chloro-1H-indol-2-yl)phenyl]-2-(thiophen-2-yl)acetamide |
| Molecular Weight: | 366.87 |
| Molecular Formula: | C20 H15 Cl N2 O S |
| Smiles: | C(C(Nc1ccc(cc1)c1cc2cc(ccc2[nH]1)[Cl])=O)c1cccs1 |
| Stereo: | ACHIRAL |
| logP: | 5.2603 |
| logD: | 5.2602 |
| logSw: | -5.8859 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 33.212 |
| InChI Key: | IPRFGKXFNWIGBK-UHFFFAOYSA-N |