N-{[4-(dimethylamino)phenyl]methyl}-2-methyl-8-(4-methylphenyl)quinoline-4-carboxamide
Chemical Structure Depiction of
N-{[4-(dimethylamino)phenyl]methyl}-2-methyl-8-(4-methylphenyl)quinoline-4-carboxamide
N-{[4-(dimethylamino)phenyl]methyl}-2-methyl-8-(4-methylphenyl)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | F941-0685 |
| Compound Name: | N-{[4-(dimethylamino)phenyl]methyl}-2-methyl-8-(4-methylphenyl)quinoline-4-carboxamide |
| Molecular Weight: | 409.53 |
| Molecular Formula: | C27 H27 N3 O |
| Smiles: | Cc1ccc(cc1)c1cccc2c(cc(C)nc12)C(NCc1ccc(cc1)N(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 5.7635 |
| logD: | 5.7481 |
| logSw: | -5.6785 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.092 |
| InChI Key: | XAYRYHCAJYSNHR-UHFFFAOYSA-N |