N-{1-[4-(4-ethylpiperazine-1-carbonyl)phenyl]-3-methyl-4-phenyl-1H-pyrazol-5-yl}acetamide
Chemical Structure Depiction of
N-{1-[4-(4-ethylpiperazine-1-carbonyl)phenyl]-3-methyl-4-phenyl-1H-pyrazol-5-yl}acetamide
N-{1-[4-(4-ethylpiperazine-1-carbonyl)phenyl]-3-methyl-4-phenyl-1H-pyrazol-5-yl}acetamide
Compound characteristics
| Compound ID: | F944-0169 |
| Compound Name: | N-{1-[4-(4-ethylpiperazine-1-carbonyl)phenyl]-3-methyl-4-phenyl-1H-pyrazol-5-yl}acetamide |
| Molecular Weight: | 431.54 |
| Molecular Formula: | C25 H29 N5 O2 |
| Smiles: | CCN1CCN(CC1)C(c1ccc(cc1)n1c(c(c2ccccc2)c(C)n1)NC(C)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9757 |
| logD: | 1.7995 |
| logSw: | -2.4425 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.504 |
| InChI Key: | JRJMVMWJDCIBMB-UHFFFAOYSA-N |