5-(3,5-dimethyl-1-benzofuran-2-yl)-N-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxamide
Chemical Structure Depiction of
5-(3,5-dimethyl-1-benzofuran-2-yl)-N-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxamide
5-(3,5-dimethyl-1-benzofuran-2-yl)-N-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxamide
Compound characteristics
| Compound ID: | F953-0960 |
| Compound Name: | 5-(3,5-dimethyl-1-benzofuran-2-yl)-N-(3-methoxypropyl)-1,3,4-oxadiazole-2-carboxamide |
| Molecular Weight: | 329.35 |
| Molecular Formula: | C17 H19 N3 O4 |
| Smiles: | Cc1ccc2c(c1)c(C)c(c1nnc(C(NCCCOC)=O)o1)o2 |
| Stereo: | ACHIRAL |
| logP: | 2.4999 |
| logD: | 2.4999 |
| logSw: | -2.8239 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.149 |
| InChI Key: | FKDUKLOAVYIFFK-UHFFFAOYSA-N |