N-(3-chloro-4-fluorophenyl)-4-[1-(4-fluorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]piperazine-1-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-4-[1-(4-fluorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]piperazine-1-carboxamide
N-(3-chloro-4-fluorophenyl)-4-[1-(4-fluorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]piperazine-1-carboxamide
Compound characteristics
| Compound ID: | F978-0206 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-4-[1-(4-fluorophenyl)-6-oxo-1,6-dihydropyridazin-3-yl]piperazine-1-carboxamide |
| Molecular Weight: | 445.85 |
| Molecular Formula: | C21 H18 Cl F2 N5 O2 |
| Smiles: | C1CN(CCN1C1C=CC(N(c2ccc(cc2)F)N=1)=O)C(Nc1ccc(c(c1)[Cl])F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3949 |
| logD: | 3.3943 |
| logSw: | -3.8088 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.982 |
| InChI Key: | HWOLCEJQPUJSPJ-UHFFFAOYSA-N |