4-(3-methyl-2-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}-1-benzofuran-5-sulfonyl)thiomorpholine
Chemical Structure Depiction of
4-(3-methyl-2-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}-1-benzofuran-5-sulfonyl)thiomorpholine
4-(3-methyl-2-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}-1-benzofuran-5-sulfonyl)thiomorpholine
Compound characteristics
| Compound ID: | F987-0111 |
| Compound Name: | 4-(3-methyl-2-{3-[4-(methylsulfanyl)phenyl]-1,2,4-oxadiazol-5-yl}-1-benzofuran-5-sulfonyl)thiomorpholine |
| Molecular Weight: | 487.62 |
| Molecular Formula: | C22 H21 N3 O4 S3 |
| Smiles: | Cc1c2cc(ccc2oc1c1nc(c2ccc(cc2)SC)no1)S(N1CCSCC1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6574 |
| logD: | 5.6574 |
| logSw: | -5.6871 |
| Hydrogen bond acceptors count: | 11 |
| Polar surface area: | 71.881 |
| InChI Key: | OCGZPLBYVJSFSY-UHFFFAOYSA-N |