1-[4-(benzyloxy)phenyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1H-1,2,3-triazol-5-amine
Chemical Structure Depiction of
1-[4-(benzyloxy)phenyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1H-1,2,3-triazol-5-amine
1-[4-(benzyloxy)phenyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1H-1,2,3-triazol-5-amine
Compound characteristics
| Compound ID: | F988-0918 |
| Compound Name: | 1-[4-(benzyloxy)phenyl]-4-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]-1H-1,2,3-triazol-5-amine |
| Molecular Weight: | 443.5 |
| Molecular Formula: | C24 H18 F N5 O S |
| Smiles: | C(c1ccccc1)Oc1ccc(cc1)n1c(c(c2nc(cs2)c2ccc(cc2)F)nn1)N |
| Stereo: | ACHIRAL |
| logP: | 5.4655 |
| logD: | 5.4655 |
| logSw: | -5.9905 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.022 |
| InChI Key: | JECKYWWRAVUANB-UHFFFAOYSA-N |