4-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-1-(3-ethylphenyl)-1H-1,2,3-triazol-5-amine
Chemical Structure Depiction of
4-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-1-(3-ethylphenyl)-1H-1,2,3-triazol-5-amine
4-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-1-(3-ethylphenyl)-1H-1,2,3-triazol-5-amine
Compound characteristics
| Compound ID: | F988-1128 |
| Compound Name: | 4-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-1-(3-ethylphenyl)-1H-1,2,3-triazol-5-amine |
| Molecular Weight: | 375.49 |
| Molecular Formula: | C21 H21 N5 S |
| Smiles: | CCc1cccc(c1)n1c(c(c2nc(cs2)c2cc(C)ccc2C)nn1)N |
| Stereo: | ACHIRAL |
| logP: | 5.4506 |
| logD: | 5.4506 |
| logSw: | -5.6663 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 55.795 |
| InChI Key: | AEYLJANXTURKOG-UHFFFAOYSA-N |