4-[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-(3-methoxyphenyl)phthalazin-1(2H)-one
Chemical Structure Depiction of
4-[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-(3-methoxyphenyl)phthalazin-1(2H)-one
4-[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-(3-methoxyphenyl)phthalazin-1(2H)-one
Compound characteristics
| Compound ID: | F990-0126 |
| Compound Name: | 4-[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]-2-(3-methoxyphenyl)phthalazin-1(2H)-one |
| Molecular Weight: | 456.46 |
| Molecular Formula: | C25 H20 N4 O5 |
| Smiles: | COc1cccc(c1)N1C(c2ccccc2C(c2nc(c3ccc(cc3OC)OC)no2)=N1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5752 |
| logD: | 4.5681 |
| logSw: | -4.6025 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 80.171 |
| InChI Key: | PNCZHOLKJGRSSR-UHFFFAOYSA-N |