N-(4-fluorophenyl)-N-({4-[(morpholin-4-yl)methyl]thiophen-2-yl}methyl)thiophene-2-sulfonamide
Chemical Structure Depiction of
N-(4-fluorophenyl)-N-({4-[(morpholin-4-yl)methyl]thiophen-2-yl}methyl)thiophene-2-sulfonamide
N-(4-fluorophenyl)-N-({4-[(morpholin-4-yl)methyl]thiophen-2-yl}methyl)thiophene-2-sulfonamide
Compound characteristics
| Compound ID: | F997-0723 |
| Compound Name: | N-(4-fluorophenyl)-N-({4-[(morpholin-4-yl)methyl]thiophen-2-yl}methyl)thiophene-2-sulfonamide |
| Molecular Weight: | 452.59 |
| Molecular Formula: | C20 H21 F N2 O3 S3 |
| Smiles: | C1COCCN1Cc1cc(CN(c2ccc(cc2)F)S(c2cccs2)(=O)=O)sc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3982 |
| logD: | 2.2933 |
| logSw: | -3.5906 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 45.47 |
| InChI Key: | YXSOCMKIKNELKL-UHFFFAOYSA-N |