1'-methylspiro[[1,3]benzoxazine-2,4'-piperidin]-4(3H)-one
Chemical Structure Depiction of
1'-methylspiro[[1,3]benzoxazine-2,4'-piperidin]-4(3H)-one
1'-methylspiro[[1,3]benzoxazine-2,4'-piperidin]-4(3H)-one
Compound characteristics
| Compound ID: | FF01-0445 |
| Compound Name: | 1'-methylspiro[[1,3]benzoxazine-2,4'-piperidin]-4(3H)-one |
| Molecular Weight: | 232.28 |
| Molecular Formula: | C13 H16 N2 O2 |
| Smiles: | CN1CCC2(CC1)NC(c1ccccc1O2)=O |
| Stereo: | ACHIRAL |
| logP: | 0.8405 |
| logD: | -0.9379 |
| logSw: | -2.2711 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 36.142 |
| InChI Key: | MQHAYMCVXJVJDU-UHFFFAOYSA-N |