1-{4-[(4-methylcyclohexyl)amino]piperidin-1-yl}ethan-1-one
Chemical Structure Depiction of
1-{4-[(4-methylcyclohexyl)amino]piperidin-1-yl}ethan-1-one
1-{4-[(4-methylcyclohexyl)amino]piperidin-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | FF01-1265 |
| Compound Name: | 1-{4-[(4-methylcyclohexyl)amino]piperidin-1-yl}ethan-1-one |
| Molecular Weight: | 238.37 |
| Molecular Formula: | C14 H26 N2 O |
| Smiles: | CC1CCC(CC1)NC1CCN(CC1)C(C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9665 |
| logD: | -0.9351 |
| logSw: | -3.1533 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 28.4413 |
| InChI Key: | WIEIGZKHHGDNGV-UHFFFAOYSA-N |