1-(thiophene-2-sulfonyl)piperazine--hydrogen chloride (1/1)
Chemical Structure Depiction of
1-(thiophene-2-sulfonyl)piperazine--hydrogen chloride (1/1)
1-(thiophene-2-sulfonyl)piperazine--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | FF01-4905 |
| Compound Name: | 1-(thiophene-2-sulfonyl)piperazine--hydrogen chloride (1/1) |
| Molecular Weight: | 268.78 |
| Molecular Formula: | C8 H12 N2 O2 S2 |
| Salt: | HCl |
| Smiles: | C1CN(CCN1)S(c1cccs1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.4756 |
| logD: | 0.0459 |
| logSw: | -2.1017 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 44.928 |
| InChI Key: | JEVLAMZYGHEJIS-UHFFFAOYSA-N |