5-[(piperidin-1-yl)methyl]furan-2-carbohydrazide
Chemical Structure Depiction of
5-[(piperidin-1-yl)methyl]furan-2-carbohydrazide
5-[(piperidin-1-yl)methyl]furan-2-carbohydrazide
Compound characteristics
| Compound ID: | FF01-5325 |
| Compound Name: | 5-[(piperidin-1-yl)methyl]furan-2-carbohydrazide |
| Molecular Weight: | 223.27 |
| Molecular Formula: | C11 H17 N3 O2 |
| Smiles: | C1CCN(CC1)Cc1ccc(C(NN)=O)o1 |
| Stereo: | ACHIRAL |
| logP: | 0.4266 |
| logD: | -0.0927 |
| logSw: | -1.6107 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 60.718 |
| InChI Key: | LOYHPTLRLLWTII-UHFFFAOYSA-N |