5-(4-fluorophenyl)-3-{[(4-methoxyphenyl)methyl]amino}-4-methyl-1H-1lambda~6~,2-thiazole-1,1-dione
Chemical Structure Depiction of
5-(4-fluorophenyl)-3-{[(4-methoxyphenyl)methyl]amino}-4-methyl-1H-1lambda~6~,2-thiazole-1,1-dione
5-(4-fluorophenyl)-3-{[(4-methoxyphenyl)methyl]amino}-4-methyl-1H-1lambda~6~,2-thiazole-1,1-dione
Compound characteristics
| Compound ID: | G001-0739 |
| Compound Name: | 5-(4-fluorophenyl)-3-{[(4-methoxyphenyl)methyl]amino}-4-methyl-1H-1lambda~6~,2-thiazole-1,1-dione |
| Molecular Weight: | 360.41 |
| Molecular Formula: | C18 H17 F N2 O3 S |
| Smiles: | CC1=C(c2ccc(cc2)F)S(N=C1NCc1ccc(cc1)OC)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9114 |
| logD: | 2.9114 |
| logSw: | -3.4375 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.71 |
| InChI Key: | WKWHMKZTLLNGRC-UHFFFAOYSA-N |