N-(3-chloro-4-methylphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide
N-(3-chloro-4-methylphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G008-1120 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-2-methyl-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide |
| Molecular Weight: | 376.86 |
| Molecular Formula: | C18 H17 Cl N2 O3 S |
| Smiles: | Cc1ccc(cc1S(Nc1ccc(C)c(c1)[Cl])(=O)=O)c1cc(C)no1 |
| Stereo: | ACHIRAL |
| logP: | 5.2716 |
| logD: | 3.6613 |
| logSw: | -6.0554 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 62.23 |
| InChI Key: | WKCORUNPBJBZSW-UHFFFAOYSA-N |