N-[4-(diethylamino)-2-methylphenyl]-2-methoxy-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide
Chemical Structure Depiction of
N-[4-(diethylamino)-2-methylphenyl]-2-methoxy-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide
N-[4-(diethylamino)-2-methylphenyl]-2-methoxy-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G008-1403 |
| Compound Name: | N-[4-(diethylamino)-2-methylphenyl]-2-methoxy-5-(3-methyl-1,2-oxazol-5-yl)benzene-1-sulfonamide |
| Molecular Weight: | 429.54 |
| Molecular Formula: | C22 H27 N3 O4 S |
| Smiles: | CCN(CC)c1ccc(c(C)c1)NS(c1cc(ccc1OC)c1cc(C)no1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.363 |
| logD: | 3.6232 |
| logSw: | -4.2948 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.898 |
| InChI Key: | UFSYNHPZSPZHRH-UHFFFAOYSA-N |