5-(3,4-dimethyl-1,2-oxazol-5-yl)-N,2-dimethyl-N-(4-methylphenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
5-(3,4-dimethyl-1,2-oxazol-5-yl)-N,2-dimethyl-N-(4-methylphenyl)benzene-1-sulfonamide
5-(3,4-dimethyl-1,2-oxazol-5-yl)-N,2-dimethyl-N-(4-methylphenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G008-2029 |
| Compound Name: | 5-(3,4-dimethyl-1,2-oxazol-5-yl)-N,2-dimethyl-N-(4-methylphenyl)benzene-1-sulfonamide |
| Molecular Weight: | 370.47 |
| Molecular Formula: | C20 H22 N2 O3 S |
| Smiles: | Cc1ccc(cc1)N(C)S(c1cc(ccc1C)c1c(C)c(C)no1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1267 |
| logD: | 5.1267 |
| logSw: | -5.0702 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.405 |
| InChI Key: | SVHBSPMUMIREKE-UHFFFAOYSA-N |