5-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-fluorophenyl)-2-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
5-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-fluorophenyl)-2-methoxybenzene-1-sulfonamide
5-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-fluorophenyl)-2-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | G008-2127 |
| Compound Name: | 5-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-fluorophenyl)-2-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 376.4 |
| Molecular Formula: | C18 H17 F N2 O4 S |
| Smiles: | Cc1c(C)noc1c1ccc(c(c1)S(Nc1ccccc1F)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.7384 |
| logD: | 2.8901 |
| logSw: | -4.1343 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 70.166 |
| InChI Key: | MFYLDKSERACYTN-UHFFFAOYSA-N |