1'-[5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonyl]-1,4'-bipiperidine
Chemical Structure Depiction of
1'-[5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonyl]-1,4'-bipiperidine
1'-[5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonyl]-1,4'-bipiperidine
Compound characteristics
| Compound ID: | G008-2192 |
| Compound Name: | 1'-[5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxybenzene-1-sulfonyl]-1,4'-bipiperidine |
| Molecular Weight: | 433.57 |
| Molecular Formula: | C22 H31 N3 O4 S |
| Smiles: | Cc1c(C)noc1c1ccc(c(c1)S(N1CCC(CC1)N1CCCCC1)(=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 3.6081 |
| logD: | 1.3491 |
| logSw: | -3.8061 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 65.018 |
| InChI Key: | RAYKAXOUPQOMCX-UHFFFAOYSA-N |