5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxy-N-methyl-N-(3-methylphenyl)benzene-1-sulfonamide
Chemical Structure Depiction of
5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxy-N-methyl-N-(3-methylphenyl)benzene-1-sulfonamide
5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxy-N-methyl-N-(3-methylphenyl)benzene-1-sulfonamide
Compound characteristics
| Compound ID: | G008-2236 |
| Compound Name: | 5-(3,4-dimethyl-1,2-oxazol-5-yl)-2-methoxy-N-methyl-N-(3-methylphenyl)benzene-1-sulfonamide |
| Molecular Weight: | 386.47 |
| Molecular Formula: | C20 H22 N2 O4 S |
| Smiles: | Cc1cccc(c1)N(C)S(c1cc(ccc1OC)c1c(C)c(C)no1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.64 |
| logD: | 4.64 |
| logSw: | -4.5453 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 63.035 |
| InChI Key: | YVQNDNYORJNPMG-UHFFFAOYSA-N |